|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Ethyl[(1-methylpiperidin-2-yl)methyl]amine |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Ethyl[(1-methyl-1H-pyrazol-4-yl)methyl]amine Ethyl[(1-isopropylpyrrolidin-2-yl)methyl]amine Ethyl[(1-isopropylpiperidin-2-yl)methyl]amine Ethyl[(1-ethylpyrrolidin-2-yl)methyl]amine Ethyl[(1-ethylpiperidin-2-yl)methyl]amine Ethylzinc bromide, 0.50 m in thf Ethylylidene triacetate Ethylvanillinbeta-D-glucopyranoside Ethylurea Ethyltyrosylarginine methyl ester Ethyltritylether Ethyltris(2-hydroxypropyl)ammonium ethyl sulfate Ethyltris(2-hydroxyethyl)ammonium ethyl sulfate Ethyltris(2-ethylhexyl)ammonium chloride Ethyltris(2-ethylhexyl)ammonium bromide Ethyltris(1-methylethoxy)silane Ethyltripropyltin Ethyltripropylammonium Ethyltriphenyltin Ethyltriphenylphosphonium tetrafluoroborate Ethyltriphenylphosphonium phenolate Ethyltriphenylphosphonium iodide Ethyltriphenylphosphonium chloride Ethyltriphenylphosphonium bromide Ethyltriphenylphosphonium bis(trifluoromethylsulfony)imide Ethyltriphenylphosphonium acetate Ethyltripentyltin Ethyltrimethyltin(IV) Ethyltrimethylsilane Ethyltrimethylplumbane Ethyltrimethylammoniumbromide Ethyltrimethylammonium iodide Ethyltrimethylammonium 2-acetoxy-5-oxo-L-prolinate Ethyltrimethylaminium·chloride Ethyltrimethoxysilane Ethyltriiodogermane Ethyltriglycolmethacrylate Ethyltrifluorosilane Ethyltriethoxysilane Ethyltriethoxygermane Ethyltricyclohexyltin Ethyltrichlorosilane Ethyltributyltin Ethyltributylphosphonium ethyl sulfate Ethyltributylphosphonium bromide Ethyltri-n-propylammonium iodide Ethyltri(octadecyl)ammonium ethyl sulfate Ethyltrans-4-bromocinnamate Ethylthiophosphonic acid O-isopropyl O-(2-chloro-4-nitrophenyl) ester Ethylthiophosphonic acid O-ethyl O-[4-(methylsulfinyl)phenyl] ester
|
|
|
|
|
|
|
|